C13H28N2O2S — CID 102886877
2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-N-propylpentan-1-amine (PubChem CID 102886877) has the molecular formula C13H28N2O2S and a molecular weight of 276.45 g/mol. Its IUPAC name is 2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-N-propylpentan-1-amine.
| Compound Name | 2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 102886877 |
| Molecular Formula | C13H28N2O2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-N-propylpentan-1-amine |
| SMILES | CCCNCC(CCC)N1CCS(=O)(=O)CC1C |
| InChI | InChI=1S/C13H28N2O2S/c1-4-6-13(10-14-7-5-2)15-8-9-18(16,17)11-12(15)3/h12-14H,4-11H2,1-3H3 |
| InChIKey | LNJSJVQUOASHKD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|