C9H17NO7S2 — CID 62085300
2-[(1,1-dioxothian-4-yl)sulfonylamino]-4-hydroxybutanoic acid (PubChem CID 62085300) has the molecular formula C9H17NO7S2 and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-[(1,1-dioxothian-4-yl)sulfonylamino]-4-hydroxybutanoic acid.
| Compound Name | 2-[(1,1-dioxothian-4-yl)sulfonylamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 62085300 |
| Molecular Formula | C9H17NO7S2 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 2-[(1,1-dioxothian-4-yl)sulfonylamino]-4-hydroxybutanoic acid |
| SMILES | O=C(O)C(CCO)NS(=O)(=O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H17NO7S2/c11-4-1-8(9(12)13)10-19(16,17)7-2-5-18(14,15)6-3-7/h7-8,10-11H,1-6H2,(H,12,13) |
| InChIKey | UIJHCIOVOKKLGK-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |