C11H15NO6S3 — CID 115284341
2-[(1,1-dioxothian-4-yl)sulfonylamino]-2-thiophen-2-ylacetic acid (PubChem CID 115284341) has the molecular formula C11H15NO6S3 and a molecular weight of 353.44 g/mol. Its IUPAC name is 2-[(1,1-dioxothian-4-yl)sulfonylamino]-2-thiophen-2-ylacetic acid.
| Compound Name | 2-[(1,1-dioxothian-4-yl)sulfonylamino]-2-thiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 115284341 |
| Molecular Formula | C11H15NO6S3 |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 2-[(1,1-dioxothian-4-yl)sulfonylamino]-2-thiophen-2-ylacetic acid |
| SMILES | O=C(O)C(NS(=O)(=O)C1CCS(=O)(=O)CC1)c1cccs1 |
| InChI | InChI=1S/C11H15NO6S3/c13-11(14)10(9-2-1-5-19-9)12-21(17,18)8-3-6-20(15,16)7-4-8/h1-2,5,8,10,12H,3-4,6-7H2,(H,13,14) |
| InChIKey | ZVLKGGSCEDKZTQ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |