C10H19N3O5S — CID 43210817
4-amino-2-[(2-methylpiperidin-1-yl)sulfonylamino]-4-oxobutanoic acid (PubChem CID 43210817) has the molecular formula C10H19N3O5S and a molecular weight of 293.35 g/mol. Its IUPAC name is 4-amino-2-[(2-methylpiperidin-1-yl)sulfonylamino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[(2-methylpiperidin-1-yl)sulfonylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 43210817 |
| Molecular Formula | C10H19N3O5S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 4-amino-2-[(2-methylpiperidin-1-yl)sulfonylamino]-4-oxobutanoic acid |
| SMILES | CC1CCCCN1S(=O)(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C10H19N3O5S/c1-7-4-2-3-5-13(7)19(17,18)12-8(10(15)16)6-9(11)14/h7-8,12H,2-6H2,1H3,(H2,11,14)(H,15,16) |
| InChIKey | BZRITLGXGURBAR-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |