C13H27N3O3S — CID 124727544
(2R)-N-tert-butyl-2-[[(2R)-2-methylpiperidin-1-yl]sulfonylamino]propanamide (PubChem CID 124727544) has the molecular formula C13H27N3O3S and a molecular weight of 305.44 g/mol. Its IUPAC name is (2R)-N-tert-butyl-2-[[(2R)-2-methylpiperidin-1-yl]sulfonylamino]propanamide.
| Compound Name | (2R)-N-tert-butyl-2-[[(2R)-2-methylpiperidin-1-yl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 124727544 |
| Molecular Formula | C13H27N3O3S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | (2R)-N-tert-butyl-2-[[(2R)-2-methylpiperidin-1-yl]sulfonylamino]propanamide |
| SMILES | C[C@@H]1CCCCN1S(=O)(=O)N[C@H](C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C13H27N3O3S/c1-10-8-6-7-9-16(10)20(18,19)15-11(2)12(17)14-13(3,4)5/h10-11,15H,6-9H2,1-5H3,(H,14,17)/t10-,11-/m1/s1 |
| InChIKey | DANYIDZQAVWPEG-GHMZBOCLSA-N |
| XLogP | 1.00 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |