C14H27N3O5S — CID 138047842
tert-butyl 1-[[(2R)-1-(methylamino)-1-oxopropan-2-yl]sulfamoyl]piperidine-2-carboxylate (PubChem CID 138047842) has the molecular formula C14H27N3O5S and a molecular weight of 349.45 g/mol. Its IUPAC name is tert-butyl 1-[[(2R)-1-(methylamino)-1-oxopropan-2-yl]sulfamoyl]piperidine-2-carboxylate.
| Compound Name | tert-butyl 1-[[(2R)-1-(methylamino)-1-oxopropan-2-yl]sulfamoyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 138047842 |
| Molecular Formula | C14H27N3O5S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | tert-butyl 1-[[(2R)-1-(methylamino)-1-oxopropan-2-yl]sulfamoyl]piperidine-2-carboxylate |
| SMILES | CNC(=O)[C@@H](C)NS(=O)(=O)N1CCCCC1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H27N3O5S/c1-10(12(18)15-5)16-23(20,21)17-9-7-6-8-11(17)13(19)22-14(2,3)4/h10-11,16H,6-9H2,1-5H3,(H,15,18)/t10-,11?/m1/s1 |
| InChIKey | PPDCJYZHNXDNLK-NFJWQWPMSA-N |
| XLogP | 0.15 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |