C14H25N3O4 — CID 115537272
tert-butyl (2S)-1-[1-(methylcarbamoylamino)-1-oxopropan-2-yl]pyrrolidine-2-carboxylate (PubChem CID 115537272) has the molecular formula C14H25N3O4 and a molecular weight of 299.37 g/mol. Its IUPAC name is tert-butyl (2S)-1-[1-(methylcarbamoylamino)-1-oxopropan-2-yl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[1-(methylcarbamoylamino)-1-oxopropan-2-yl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 115537272 |
| Molecular Formula | C14H25N3O4 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | tert-butyl (2S)-1-[1-(methylcarbamoylamino)-1-oxopropan-2-yl]pyrrolidine-2-carboxylate |
| SMILES | CNC(=O)NC(=O)C(C)N1CCC[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25N3O4/c1-9(11(18)16-13(20)15-5)17-8-6-7-10(17)12(19)21-14(2,3)4/h9-10H,6-8H2,1-5H3,(H2,15,16,18,20)/t9?,10-/m0/s1 |
| InChIKey | PUSFLMIIWLAMOH-AXDSSHIGSA-N |
| XLogP | 0.64 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |