C16H30N2O3 — CID 115537692
tert-butyl (2R)-1-[1-(butylamino)-1-oxopropan-2-yl]pyrrolidine-2-carboxylate (PubChem CID 115537692) has the molecular formula C16H30N2O3 and a molecular weight of 298.43 g/mol. Its IUPAC name is tert-butyl (2R)-1-[1-(butylamino)-1-oxopropan-2-yl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2R)-1-[1-(butylamino)-1-oxopropan-2-yl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 115537692 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | tert-butyl (2R)-1-[1-(butylamino)-1-oxopropan-2-yl]pyrrolidine-2-carboxylate |
| SMILES | CCCCNC(=O)C(C)N1CCC[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H30N2O3/c1-6-7-10-17-14(19)12(2)18-11-8-9-13(18)15(20)21-16(3,4)5/h12-13H,6-11H2,1-5H3,(H,17,19)/t12?,13-/m1/s1 |
| InChIKey | ZWMNLNXVKOSLCX-ZGTCLIOFSA-N |
| XLogP | 2.10 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|