C11H20N2O6S — CID 104929274
tert-butyl (2R)-1-(methoxycarbonylsulfamoyl)pyrrolidine-2-carboxylate (PubChem CID 104929274) has the molecular formula C11H20N2O6S and a molecular weight of 308.36 g/mol. Its IUPAC name is tert-butyl (2R)-1-(methoxycarbonylsulfamoyl)pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2R)-1-(methoxycarbonylsulfamoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 104929274 |
| Molecular Formula | C11H20N2O6S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | tert-butyl (2R)-1-(methoxycarbonylsulfamoyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)NS(=O)(=O)N1CCC[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H20N2O6S/c1-11(2,3)19-9(14)8-6-5-7-13(8)20(16,17)12-10(15)18-4/h8H,5-7H2,1-4H3,(H,12,15)/t8-/m1/s1 |
| InChIKey | OQBNCGNBZRTSIL-MRVPVSSYSA-N |
| XLogP | 0.39 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |