C12H23NO5S — CID 81004501
tert-butyl (2S)-1-(2-methoxyethylsulfonyl)pyrrolidine-2-carboxylate (PubChem CID 81004501) has the molecular formula C12H23NO5S and a molecular weight of 293.38 g/mol. Its IUPAC name is tert-butyl (2S)-1-(2-methoxyethylsulfonyl)pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-(2-methoxyethylsulfonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 81004501 |
| Molecular Formula | C12H23NO5S |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | tert-butyl (2S)-1-(2-methoxyethylsulfonyl)pyrrolidine-2-carboxylate |
| SMILES | COCCS(=O)(=O)N1CCC[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H23NO5S/c1-12(2,3)18-11(14)10-6-5-7-13(10)19(15,16)9-8-17-4/h10H,5-9H2,1-4H3/t10-/m0/s1 |
| InChIKey | CJLSIYZVBJWPML-JTQLQIEISA-N |
| XLogP | 0.77 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |