C14H19ClN2O4S — CID 110306006
(2S)-N-(4-chlorophenyl)-1-(2-methoxyethylsulfonyl)pyrrolidine-2-carboxamide (PubChem CID 110306006) has the molecular formula C14H19ClN2O4S and a molecular weight of 346.84 g/mol. Its IUPAC name is (2S)-N-(4-chlorophenyl)-1-(2-methoxyethylsulfonyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(4-chlorophenyl)-1-(2-methoxyethylsulfonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110306006 |
| Molecular Formula | C14H19ClN2O4S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | (2S)-N-(4-chlorophenyl)-1-(2-methoxyethylsulfonyl)pyrrolidine-2-carboxamide |
| SMILES | COCCS(=O)(=O)N1CCC[C@H]1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H19ClN2O4S/c1-21-9-10-22(19,20)17-8-2-3-13(17)14(18)16-12-6-4-11(15)5-7-12/h4-7,13H,2-3,8-10H2,1H3,(H,16,18)/t13-/m0/s1 |
| InChIKey | NCIZDDBWAWVIFQ-ZDUSSCGKSA-N |
| XLogP | 1.72 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |