C8H17N3O4S — CID 114465274
methyl N-[2-(methylaminomethyl)pyrrolidin-1-yl]sulfonylcarbamate (PubChem CID 114465274) has the molecular formula C8H17N3O4S and a molecular weight of 251.31 g/mol. Its IUPAC name is methyl N-[2-(methylaminomethyl)pyrrolidin-1-yl]sulfonylcarbamate.
| Compound Name | methyl N-[2-(methylaminomethyl)pyrrolidin-1-yl]sulfonylcarbamate |
|---|---|
| PubChem CID | 114465274 |
| Molecular Formula | C8H17N3O4S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | methyl N-[2-(methylaminomethyl)pyrrolidin-1-yl]sulfonylcarbamate |
| SMILES | CNCC1CCCN1S(=O)(=O)NC(=O)OC |
| InChI | InChI=1S/C8H17N3O4S/c1-9-6-7-4-3-5-11(7)16(13,14)10-8(12)15-2/h7,9H,3-6H2,1-2H3,(H,10,12) |
| InChIKey | ZZSYBWZLXHVZDN-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |