C9H18N2O4S — CID 115316475
3-[2-(methylaminomethyl)pyrrolidin-1-yl]sulfonylpropanoic acid (PubChem CID 115316475) has the molecular formula C9H18N2O4S and a molecular weight of 250.32 g/mol. Its IUPAC name is 3-[2-(methylaminomethyl)pyrrolidin-1-yl]sulfonylpropanoic acid.
| Compound Name | 3-[2-(methylaminomethyl)pyrrolidin-1-yl]sulfonylpropanoic acid |
|---|---|
| PubChem CID | 115316475 |
| Molecular Formula | C9H18N2O4S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 3-[2-(methylaminomethyl)pyrrolidin-1-yl]sulfonylpropanoic acid |
| SMILES | CNCC1CCCN1S(=O)(=O)CCC(=O)O |
| InChI | InChI=1S/C9H18N2O4S/c1-10-7-8-3-2-5-11(8)16(14,15)6-4-9(12)13/h8,10H,2-7H2,1H3,(H,12,13) |
| InChIKey | AARBWLIUNHIRSG-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |