C9H21ClN2O4S2 — CID 119991282
N-methyl-1-[1-(2-methylsulfonylethylsulfonyl)pyrrolidin-2-yl]methanamine;hydrochloride (PubChem CID 119991282) has the molecular formula C9H21ClN2O4S2 and a molecular weight of 320.86 g/mol. Its IUPAC name is N-methyl-1-[1-(2-methylsulfonylethylsulfonyl)pyrrolidin-2-yl]methanamine;hydrochloride.
| Compound Name | N-methyl-1-[1-(2-methylsulfonylethylsulfonyl)pyrrolidin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119991282 |
| Molecular Formula | C9H21ClN2O4S2 |
| Molecular Weight | 320.86 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | N-methyl-1-[1-(2-methylsulfonylethylsulfonyl)pyrrolidin-2-yl]methanamine;hydrochloride |
| SMILES | CNCC1CCCN1S(=O)(=O)CCS(C)(=O)=O.Cl |
| InChI | InChI=1S/C9H20N2O4S2.ClH/c1-10-8-9-4-3-5-11(9)17(14,15)7-6-16(2,12)13;/h9-10H,3-8H2,1-2H3;1H |
| InChIKey | BCXDHQQBWPKGNM-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.86 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |