C10H19NO6S2 — CID 63245000
2-[1-(2-methylsulfonylethylsulfonyl)piperidin-2-yl]acetic acid (PubChem CID 63245000) has the molecular formula C10H19NO6S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-[1-(2-methylsulfonylethylsulfonyl)piperidin-2-yl]acetic acid.
| Compound Name | 2-[1-(2-methylsulfonylethylsulfonyl)piperidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 63245000 |
| Molecular Formula | C10H19NO6S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-[1-(2-methylsulfonylethylsulfonyl)piperidin-2-yl]acetic acid |
| SMILES | CS(=O)(=O)CCS(=O)(=O)N1CCCCC1CC(=O)O |
| InChI | InChI=1S/C10H19NO6S2/c1-18(14,15)6-7-19(16,17)11-5-3-2-4-9(11)8-10(12)13/h9H,2-8H2,1H3,(H,12,13) |
| InChIKey | PAZXKKNJTWDILU-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |