C10H20N2O4S — CID 113285289
4-[2-(methylaminomethyl)pyrrolidin-1-yl]sulfonylbutanoic acid (PubChem CID 113285289) has the molecular formula C10H20N2O4S and a molecular weight of 264.35 g/mol. Its IUPAC name is 4-[2-(methylaminomethyl)pyrrolidin-1-yl]sulfonylbutanoic acid.
| Compound Name | 4-[2-(methylaminomethyl)pyrrolidin-1-yl]sulfonylbutanoic acid |
|---|---|
| PubChem CID | 113285289 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 4-[2-(methylaminomethyl)pyrrolidin-1-yl]sulfonylbutanoic acid |
| SMILES | CNCC1CCCN1S(=O)(=O)CCCC(=O)O |
| InChI | InChI=1S/C10H20N2O4S/c1-11-8-9-4-2-6-12(9)17(15,16)7-3-5-10(13)14/h9,11H,2-8H2,1H3,(H,13,14) |
| InChIKey | YYYUKJFXBPSMKS-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |