C13H21ClN2O2S — CID 119991099
1-(1-benzylsulfonylpyrrolidin-2-yl)-N-methylmethanamine;hydrochloride (PubChem CID 119991099) has the molecular formula C13H21ClN2O2S and a molecular weight of 304.84 g/mol. Its IUPAC name is 1-(1-benzylsulfonylpyrrolidin-2-yl)-N-methylmethanamine;hydrochloride.
| Compound Name | 1-(1-benzylsulfonylpyrrolidin-2-yl)-N-methylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 119991099 |
| Molecular Formula | C13H21ClN2O2S |
| Molecular Weight | 304.84 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1-(1-benzylsulfonylpyrrolidin-2-yl)-N-methylmethanamine;hydrochloride |
| SMILES | CNCC1CCCN1S(=O)(=O)Cc1ccccc1.Cl |
| InChI | InChI=1S/C13H20N2O2S.ClH/c1-14-10-13-8-5-9-15(13)18(16,17)11-12-6-3-2-4-7-12;/h2-4,6-7,13-14H,5,8-11H2,1H3;1H |
| InChIKey | KGSXRYVDQUDQFK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.84 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |