C12H26N4O2S — CID 106075380
2-(methylaminomethyl)-N-piperidin-1-ylpiperidine-1-sulfonamide (PubChem CID 106075380) has the molecular formula C12H26N4O2S and a molecular weight of 290.43 g/mol. Its IUPAC name is 2-(methylaminomethyl)-N-piperidin-1-ylpiperidine-1-sulfonamide.
| Compound Name | 2-(methylaminomethyl)-N-piperidin-1-ylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106075380 |
| Molecular Formula | C12H26N4O2S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 2-(methylaminomethyl)-N-piperidin-1-ylpiperidine-1-sulfonamide |
| SMILES | CNCC1CCCCN1S(=O)(=O)NN1CCCCC1 |
| InChI | InChI=1S/C12H26N4O2S/c1-13-11-12-7-3-6-10-16(12)19(17,18)14-15-8-4-2-5-9-15/h12-14H,2-11H2,1H3 |
| InChIKey | SZJCHOKQODDIKI-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |