C13H27N3O2S2 — CID 106091786
2-(methylaminomethyl)-N-(2-methylsulfanylcyclopentyl)piperidine-1-sulfonamide (PubChem CID 106091786) has the molecular formula C13H27N3O2S2 and a molecular weight of 321.51 g/mol. Its IUPAC name is 2-(methylaminomethyl)-N-(2-methylsulfanylcyclopentyl)piperidine-1-sulfonamide.
| Compound Name | 2-(methylaminomethyl)-N-(2-methylsulfanylcyclopentyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106091786 |
| Molecular Formula | C13H27N3O2S2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2-(methylaminomethyl)-N-(2-methylsulfanylcyclopentyl)piperidine-1-sulfonamide |
| SMILES | CNCC1CCCCN1S(=O)(=O)NC1CCCC1SC |
| InChI | InChI=1S/C13H27N3O2S2/c1-14-10-11-6-3-4-9-16(11)20(17,18)15-12-7-5-8-13(12)19-2/h11-15H,3-10H2,1-2H3 |
| InChIKey | MAPFJTHFQOVEPF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |