C14H29N3O2S2 — CID 106091710
2-(ethylaminomethyl)-N-(2-methylsulfanylcyclopentyl)piperidine-1-sulfonamide (PubChem CID 106091710) has the molecular formula C14H29N3O2S2 and a molecular weight of 335.54 g/mol. Its IUPAC name is 2-(ethylaminomethyl)-N-(2-methylsulfanylcyclopentyl)piperidine-1-sulfonamide.
| Compound Name | 2-(ethylaminomethyl)-N-(2-methylsulfanylcyclopentyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106091710 |
| Molecular Formula | C14H29N3O2S2 |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 2-(ethylaminomethyl)-N-(2-methylsulfanylcyclopentyl)piperidine-1-sulfonamide |
| SMILES | CCNCC1CCCCN1S(=O)(=O)NC1CCCC1SC |
| InChI | InChI=1S/C14H29N3O2S2/c1-3-15-11-12-7-4-5-10-17(12)21(18,19)16-13-8-6-9-14(13)20-2/h12-16H,3-11H2,1-2H3 |
| InChIKey | AYSWWOHUEILPPW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |