C10H21N3O4S — CID 112747937
propan-2-yl N-[2-(2-aminoethyl)pyrrolidin-1-yl]sulfonylcarbamate (PubChem CID 112747937) has the molecular formula C10H21N3O4S and a molecular weight of 279.36 g/mol. Its IUPAC name is propan-2-yl N-[2-(2-aminoethyl)pyrrolidin-1-yl]sulfonylcarbamate.
| Compound Name | propan-2-yl N-[2-(2-aminoethyl)pyrrolidin-1-yl]sulfonylcarbamate |
|---|---|
| PubChem CID | 112747937 |
| Molecular Formula | C10H21N3O4S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | propan-2-yl N-[2-(2-aminoethyl)pyrrolidin-1-yl]sulfonylcarbamate |
| SMILES | CC(C)OC(=O)NS(=O)(=O)N1CCCC1CCN |
| InChI | InChI=1S/C10H21N3O4S/c1-8(2)17-10(14)12-18(15,16)13-7-3-4-9(13)5-6-11/h8-9H,3-7,11H2,1-2H3,(H,12,14) |
| InChIKey | QQOPLDZXRRHSIG-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |