C13H22N2O5S — CID 114463743
propan-2-yl N-[2-(2-oxocyclopentyl)pyrrolidin-1-yl]sulfonylcarbamate (PubChem CID 114463743) has the molecular formula C13H22N2O5S and a molecular weight of 318.40 g/mol. Its IUPAC name is propan-2-yl N-[2-(2-oxocyclopentyl)pyrrolidin-1-yl]sulfonylcarbamate.
| Compound Name | propan-2-yl N-[2-(2-oxocyclopentyl)pyrrolidin-1-yl]sulfonylcarbamate |
|---|---|
| PubChem CID | 114463743 |
| Molecular Formula | C13H22N2O5S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | propan-2-yl N-[2-(2-oxocyclopentyl)pyrrolidin-1-yl]sulfonylcarbamate |
| SMILES | CC(C)OC(=O)NS(=O)(=O)N1CCCC1C1CCCC1=O |
| InChI | InChI=1S/C13H22N2O5S/c1-9(2)20-13(17)14-21(18,19)15-8-4-6-11(15)10-5-3-7-12(10)16/h9-11H,3-8H2,1-2H3,(H,14,17) |
| InChIKey | MKSMTDMMKCFFCK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |