C7H13BrN2O4S — CID 114466523
methyl N-[2-(bromomethyl)pyrrolidin-1-yl]sulfonylcarbamate (PubChem CID 114466523) has the molecular formula C7H13BrN2O4S and a molecular weight of 301.16 g/mol. Its IUPAC name is methyl N-[2-(bromomethyl)pyrrolidin-1-yl]sulfonylcarbamate.
| Compound Name | methyl N-[2-(bromomethyl)pyrrolidin-1-yl]sulfonylcarbamate |
|---|---|
| PubChem CID | 114466523 |
| Molecular Formula | C7H13BrN2O4S |
| Molecular Weight | 301.16 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | methyl N-[2-(bromomethyl)pyrrolidin-1-yl]sulfonylcarbamate |
| SMILES | COC(=O)NS(=O)(=O)N1CCCC1CBr |
| InChI | InChI=1S/C7H13BrN2O4S/c1-14-7(11)9-15(12,13)10-4-2-3-6(10)5-8/h6H,2-5H2,1H3,(H,9,11) |
| InChIKey | VKRUXJPNNMLGGS-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.16 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|