C8H15BrN2O5S — CID 114466959
ethyl N-[3-(bromomethyl)morpholin-4-yl]sulfonylcarbamate (PubChem CID 114466959) has the molecular formula C8H15BrN2O5S and a molecular weight of 331.19 g/mol. Its IUPAC name is ethyl N-[3-(bromomethyl)morpholin-4-yl]sulfonylcarbamate.
| Compound Name | ethyl N-[3-(bromomethyl)morpholin-4-yl]sulfonylcarbamate |
|---|---|
| PubChem CID | 114466959 |
| Molecular Formula | C8H15BrN2O5S |
| Molecular Weight | 331.19 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | ethyl N-[3-(bromomethyl)morpholin-4-yl]sulfonylcarbamate |
| SMILES | CCOC(=O)NS(=O)(=O)N1CCOCC1CBr |
| InChI | InChI=1S/C8H15BrN2O5S/c1-2-16-8(12)10-17(13,14)11-3-4-15-6-7(11)5-9/h7H,2-6H2,1H3,(H,10,12) |
| InChIKey | NFBKVBBACCROEH-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.19 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|