C10H19BrN2O5S — CID 114466815
ethyl N-[4-(2-bromoethoxy)piperidin-1-yl]sulfonylcarbamate (PubChem CID 114466815) has the molecular formula C10H19BrN2O5S and a molecular weight of 359.24 g/mol. Its IUPAC name is ethyl N-[4-(2-bromoethoxy)piperidin-1-yl]sulfonylcarbamate.
| Compound Name | ethyl N-[4-(2-bromoethoxy)piperidin-1-yl]sulfonylcarbamate |
|---|---|
| PubChem CID | 114466815 |
| Molecular Formula | C10H19BrN2O5S |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | ethyl N-[4-(2-bromoethoxy)piperidin-1-yl]sulfonylcarbamate |
| SMILES | CCOC(=O)NS(=O)(=O)N1CCC(OCCBr)CC1 |
| InChI | InChI=1S/C10H19BrN2O5S/c1-2-17-10(14)12-19(15,16)13-6-3-9(4-7-13)18-8-5-11/h9H,2-8H2,1H3,(H,12,14) |
| InChIKey | LHNSNMJPDAMRIO-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|