C11H21N3O6S — CID 114465560
methyl 3-[4-(ethoxycarbonylsulfamoyl)piperazin-1-yl]propanoate (PubChem CID 114465560) has the molecular formula C11H21N3O6S and a molecular weight of 323.37 g/mol. Its IUPAC name is methyl 3-[4-(ethoxycarbonylsulfamoyl)piperazin-1-yl]propanoate.
| Compound Name | methyl 3-[4-(ethoxycarbonylsulfamoyl)piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 114465560 |
| Molecular Formula | C11H21N3O6S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | methyl 3-[4-(ethoxycarbonylsulfamoyl)piperazin-1-yl]propanoate |
| SMILES | CCOC(=O)NS(=O)(=O)N1CCN(CCC(=O)OC)CC1 |
| InChI | InChI=1S/C11H21N3O6S/c1-3-20-11(16)12-21(17,18)14-8-6-13(7-9-14)5-4-10(15)19-2/h3-9H2,1-2H3,(H,12,16) |
| InChIKey | TWJNTIXOTIGDQT-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |