C8H16ClN3O4S — CID 114466217
methyl N-[4-(2-chloroethyl)piperazin-1-yl]sulfonylcarbamate (PubChem CID 114466217) has the molecular formula C8H16ClN3O4S and a molecular weight of 285.75 g/mol. Its IUPAC name is methyl N-[4-(2-chloroethyl)piperazin-1-yl]sulfonylcarbamate.
| Compound Name | methyl N-[4-(2-chloroethyl)piperazin-1-yl]sulfonylcarbamate |
|---|---|
| PubChem CID | 114466217 |
| Molecular Formula | C8H16ClN3O4S |
| Molecular Weight | 285.75 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | methyl N-[4-(2-chloroethyl)piperazin-1-yl]sulfonylcarbamate |
| SMILES | COC(=O)NS(=O)(=O)N1CCN(CCCl)CC1 |
| InChI | InChI=1S/C8H16ClN3O4S/c1-16-8(13)10-17(14,15)12-6-4-11(3-2-9)5-7-12/h2-7H2,1H3,(H,10,13) |
| InChIKey | BROXBQVEJCTKGH-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.75 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|