C8H13N3O4S — CID 114463451
methyl N-(4-cyanopiperidin-1-yl)sulfonylcarbamate (PubChem CID 114463451) has the molecular formula C8H13N3O4S and a molecular weight of 247.28 g/mol. Its IUPAC name is methyl N-(4-cyanopiperidin-1-yl)sulfonylcarbamate.
| Compound Name | methyl N-(4-cyanopiperidin-1-yl)sulfonylcarbamate |
|---|---|
| PubChem CID | 114463451 |
| Molecular Formula | C8H13N3O4S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | methyl N-(4-cyanopiperidin-1-yl)sulfonylcarbamate |
| SMILES | COC(=O)NS(=O)(=O)N1CCC(C#N)CC1 |
| InChI | InChI=1S/C8H13N3O4S/c1-15-8(12)10-16(13,14)11-4-2-7(6-9)3-5-11/h7H,2-5H2,1H3,(H,10,12) |
| InChIKey | ILDANQGFQDXCKU-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |