C9H16N2O6S — CID 104929271
methyl (3S)-1-(methoxycarbonylsulfamoyl)piperidine-3-carboxylate (PubChem CID 104929271) has the molecular formula C9H16N2O6S and a molecular weight of 280.30 g/mol. Its IUPAC name is methyl (3S)-1-(methoxycarbonylsulfamoyl)piperidine-3-carboxylate.
| Compound Name | methyl (3S)-1-(methoxycarbonylsulfamoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 104929271 |
| Molecular Formula | C9H16N2O6S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | methyl (3S)-1-(methoxycarbonylsulfamoyl)piperidine-3-carboxylate |
| SMILES | COC(=O)NS(=O)(=O)N1CCC[C@H](C(=O)OC)C1 |
| InChI | InChI=1S/C9H16N2O6S/c1-16-8(12)7-4-3-5-11(6-7)18(14,15)10-9(13)17-2/h7H,3-6H2,1-2H3,(H,10,13)/t7-/m0/s1 |
| InChIKey | UJCHJCWEAOVVAI-ZETCQYMHSA-N |
| XLogP | -0.53 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |