C6H10N2O6S — CID 114462717
1-(methoxycarbonylsulfamoyl)azetidine-3-carboxylic acid (PubChem CID 114462717) has the molecular formula C6H10N2O6S and a molecular weight of 238.22 g/mol. Its IUPAC name is 1-(methoxycarbonylsulfamoyl)azetidine-3-carboxylic acid.
| Compound Name | 1-(methoxycarbonylsulfamoyl)azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 114462717 |
| Molecular Formula | C6H10N2O6S |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 1-(methoxycarbonylsulfamoyl)azetidine-3-carboxylic acid |
| SMILES | COC(=O)NS(=O)(=O)N1CC(C(=O)O)C1 |
| InChI | InChI=1S/C6H10N2O6S/c1-14-6(11)7-15(12,13)8-2-4(3-8)5(9)10/h4H,2-3H2,1H3,(H,7,11)(H,9,10) |
| InChIKey | IUHRDHZLJITVDQ-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |