C8H14N2O6S — CID 114462674
1-(methoxycarbonylsulfamoyl)-4-methylpyrrolidine-3-carboxylic acid (PubChem CID 114462674) has the molecular formula C8H14N2O6S and a molecular weight of 266.27 g/mol. Its IUPAC name is 1-(methoxycarbonylsulfamoyl)-4-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-(methoxycarbonylsulfamoyl)-4-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 114462674 |
| Molecular Formula | C8H14N2O6S |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 1-(methoxycarbonylsulfamoyl)-4-methylpyrrolidine-3-carboxylic acid |
| SMILES | COC(=O)NS(=O)(=O)N1CC(C)C(C(=O)O)C1 |
| InChI | InChI=1S/C8H14N2O6S/c1-5-3-10(4-6(5)7(11)12)17(14,15)9-8(13)16-2/h5-6H,3-4H2,1-2H3,(H,9,13)(H,11,12) |
| InChIKey | UUJMUEKLYCDIHB-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |