C6H11BrN2O4S — CID 114466527
methyl N-(3-bromopyrrolidin-1-yl)sulfonylcarbamate (PubChem CID 114466527) has the molecular formula C6H11BrN2O4S and a molecular weight of 287.14 g/mol. Its IUPAC name is methyl N-(3-bromopyrrolidin-1-yl)sulfonylcarbamate.
| Compound Name | methyl N-(3-bromopyrrolidin-1-yl)sulfonylcarbamate |
|---|---|
| PubChem CID | 114466527 |
| Molecular Formula | C6H11BrN2O4S |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 285.96 |
| IUPAC Name | methyl N-(3-bromopyrrolidin-1-yl)sulfonylcarbamate |
| SMILES | COC(=O)NS(=O)(=O)N1CCC(Br)C1 |
| InChI | InChI=1S/C6H11BrN2O4S/c1-13-6(10)8-14(11,12)9-3-2-5(7)4-9/h5H,2-4H2,1H3,(H,8,10) |
| InChIKey | AFEWFQRRQYZWKR-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|