C8H15N3O4S — CID 114467046
methyl N-(3-amino-3-cyclopropylazetidin-1-yl)sulfonylcarbamate (PubChem CID 114467046) has the molecular formula C8H15N3O4S and a molecular weight of 249.29 g/mol. Its IUPAC name is methyl N-(3-amino-3-cyclopropylazetidin-1-yl)sulfonylcarbamate.
| Compound Name | methyl N-(3-amino-3-cyclopropylazetidin-1-yl)sulfonylcarbamate |
|---|---|
| PubChem CID | 114467046 |
| Molecular Formula | C8H15N3O4S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | methyl N-(3-amino-3-cyclopropylazetidin-1-yl)sulfonylcarbamate |
| SMILES | COC(=O)NS(=O)(=O)N1CC(N)(C2CC2)C1 |
| InChI | InChI=1S/C8H15N3O4S/c1-15-7(12)10-16(13,14)11-4-8(9,5-11)6-2-3-6/h6H,2-5,9H2,1H3,(H,10,12) |
| InChIKey | DVNLIGAMALZHPF-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |