C9H18N4O4S — CID 107162799
methyl N-(4-carbamimidoyl-4-methylpiperidin-1-yl)sulfonylcarbamate (PubChem CID 107162799) has the molecular formula C9H18N4O4S and a molecular weight of 278.33 g/mol. Its IUPAC name is methyl N-(4-carbamimidoyl-4-methylpiperidin-1-yl)sulfonylcarbamate.
| Compound Name | methyl N-(4-carbamimidoyl-4-methylpiperidin-1-yl)sulfonylcarbamate |
|---|---|
| PubChem CID | 107162799 |
| Molecular Formula | C9H18N4O4S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | methyl N-(4-carbamimidoyl-4-methylpiperidin-1-yl)sulfonylcarbamate |
| SMILES | [H]/N=C(\N)C1(C)CCN(S(=O)(=O)NC(=O)OC)CC1 |
| InChI | InChI=1S/C9H18N4O4S/c1-9(7(10)11)3-5-13(6-4-9)18(15,16)12-8(14)17-2/h3-6H2,1-2H3,(H3,10,11)(H,12,14) |
| InChIKey | YEJPXGSDTZDXFX-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 125.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|