C13H27N3O2S — CID 107162830
1-(3,3-dimethylbutylsulfonyl)-4-methylpiperidine-4-carboximidamide (PubChem CID 107162830) has the molecular formula C13H27N3O2S and a molecular weight of 289.44 g/mol. Its IUPAC name is 1-(3,3-dimethylbutylsulfonyl)-4-methylpiperidine-4-carboximidamide.
| Compound Name | 1-(3,3-dimethylbutylsulfonyl)-4-methylpiperidine-4-carboximidamide |
|---|---|
| PubChem CID | 107162830 |
| Molecular Formula | C13H27N3O2S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 1-(3,3-dimethylbutylsulfonyl)-4-methylpiperidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)C1(C)CCN(S(=O)(=O)CCC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H27N3O2S/c1-12(2,3)7-10-19(17,18)16-8-5-13(4,6-9-16)11(14)15/h5-10H2,1-4H3,(H3,14,15) |
| InChIKey | LGPLGVNHKJPQEQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|