C10H19N3O4S2 — CID 107161358
ethyl N-(4-carbamothioyl-4-methylpiperidin-1-yl)sulfonylcarbamate (PubChem CID 107161358) has the molecular formula C10H19N3O4S2 and a molecular weight of 309.41 g/mol. Its IUPAC name is ethyl N-(4-carbamothioyl-4-methylpiperidin-1-yl)sulfonylcarbamate.
| Compound Name | ethyl N-(4-carbamothioyl-4-methylpiperidin-1-yl)sulfonylcarbamate |
|---|---|
| PubChem CID | 107161358 |
| Molecular Formula | C10H19N3O4S2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | ethyl N-(4-carbamothioyl-4-methylpiperidin-1-yl)sulfonylcarbamate |
| SMILES | CCOC(=O)NS(=O)(=O)N1CCC(C)(C(N)=S)CC1 |
| InChI | InChI=1S/C10H19N3O4S2/c1-3-17-9(14)12-19(15,16)13-6-4-10(2,5-7-13)8(11)18/h3-7H2,1-2H3,(H2,11,18)(H,12,14) |
| InChIKey | GSMCEWLUTINVRW-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|