C11H20N2O4S2 — CID 107161355
methyl 2-(4-carbamothioyl-4-methylpiperidin-1-yl)sulfonylpropanoate (PubChem CID 107161355) has the molecular formula C11H20N2O4S2 and a molecular weight of 308.43 g/mol. Its IUPAC name is methyl 2-(4-carbamothioyl-4-methylpiperidin-1-yl)sulfonylpropanoate.
| Compound Name | methyl 2-(4-carbamothioyl-4-methylpiperidin-1-yl)sulfonylpropanoate |
|---|---|
| PubChem CID | 107161355 |
| Molecular Formula | C11H20N2O4S2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | methyl 2-(4-carbamothioyl-4-methylpiperidin-1-yl)sulfonylpropanoate |
| SMILES | COC(=O)C(C)S(=O)(=O)N1CCC(C)(C(N)=S)CC1 |
| InChI | InChI=1S/C11H20N2O4S2/c1-8(9(14)17-3)19(15,16)13-6-4-11(2,5-7-13)10(12)18/h8H,4-7H2,1-3H3,(H2,12,18) |
| InChIKey | KOAZVVOZWRKLQK-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|