C8H17N3O6S2 — CID 61459480
methyl 2-(4-sulfamoylpiperazin-1-yl)sulfonylpropanoate (PubChem CID 61459480) has the molecular formula C8H17N3O6S2 and a molecular weight of 315.37 g/mol. Its IUPAC name is methyl 2-(4-sulfamoylpiperazin-1-yl)sulfonylpropanoate.
| Compound Name | methyl 2-(4-sulfamoylpiperazin-1-yl)sulfonylpropanoate |
|---|---|
| PubChem CID | 61459480 |
| Molecular Formula | C8H17N3O6S2 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | methyl 2-(4-sulfamoylpiperazin-1-yl)sulfonylpropanoate |
| SMILES | COC(=O)C(C)S(=O)(=O)N1CCN(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C8H17N3O6S2/c1-7(8(12)17-2)18(13,14)10-3-5-11(6-4-10)19(9,15)16/h7H,3-6H2,1-2H3,(H2,9,15,16) |
| InChIKey | KQPDDFUXACPACK-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |