C8H15N3O5S — CID 114464489
ethyl N-[(5-oxo-1,4-diazepan-1-yl)sulfonyl]carbamate (PubChem CID 114464489) has the molecular formula C8H15N3O5S and a molecular weight of 265.29 g/mol. Its IUPAC name is ethyl N-[(5-oxo-1,4-diazepan-1-yl)sulfonyl]carbamate.
| Compound Name | ethyl N-[(5-oxo-1,4-diazepan-1-yl)sulfonyl]carbamate |
|---|---|
| PubChem CID | 114464489 |
| Molecular Formula | C8H15N3O5S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | ethyl N-[(5-oxo-1,4-diazepan-1-yl)sulfonyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)N1CCNC(=O)CC1 |
| InChI | InChI=1S/C8H15N3O5S/c1-2-16-8(13)10-17(14,15)11-5-3-7(12)9-4-6-11/h2-6H2,1H3,(H,9,12)(H,10,13) |
| InChIKey | TYJBFMUZODTLPN-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |