C9H16N2O5S — CID 55135460
ethyl 2-[(5-oxo-1,4-diazepan-1-yl)sulfonyl]acetate (PubChem CID 55135460) has the molecular formula C9H16N2O5S and a molecular weight of 264.30 g/mol. Its IUPAC name is ethyl 2-[(5-oxo-1,4-diazepan-1-yl)sulfonyl]acetate.
| Compound Name | ethyl 2-[(5-oxo-1,4-diazepan-1-yl)sulfonyl]acetate |
|---|---|
| PubChem CID | 55135460 |
| Molecular Formula | C9H16N2O5S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | ethyl 2-[(5-oxo-1,4-diazepan-1-yl)sulfonyl]acetate |
| SMILES | CCOC(=O)CS(=O)(=O)N1CCNC(=O)CC1 |
| InChI | InChI=1S/C9H16N2O5S/c1-2-16-9(13)7-17(14,15)11-5-3-8(12)10-4-6-11/h2-7H2,1H3,(H,10,12) |
| InChIKey | WJIUTDIVEYVYII-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |