C12H23N3O4S2 — CID 63341432
ethyl 2-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]sulfonylacetate (PubChem CID 63341432) has the molecular formula C12H23N3O4S2 and a molecular weight of 337.47 g/mol. Its IUPAC name is ethyl 2-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]sulfonylacetate.
| Compound Name | ethyl 2-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]sulfonylacetate |
|---|---|
| PubChem CID | 63341432 |
| Molecular Formula | C12H23N3O4S2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | ethyl 2-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]sulfonylacetate |
| SMILES | CCOC(=O)CS(=O)(=O)N1CCN(C(C)(C)C(N)=S)CC1 |
| InChI | InChI=1S/C12H23N3O4S2/c1-4-19-10(16)9-21(17,18)15-7-5-14(6-8-15)12(2,3)11(13)20/h4-9H2,1-3H3,(H2,13,20) |
| InChIKey | OGFWXOYZIOGYBA-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|