C8H15NO6S — CID 106672320
ethyl 2-(3,4-dihydroxypyrrolidin-1-yl)sulfonylacetate (PubChem CID 106672320) has the molecular formula C8H15NO6S and a molecular weight of 253.28 g/mol. Its IUPAC name is ethyl 2-(3,4-dihydroxypyrrolidin-1-yl)sulfonylacetate.
| Compound Name | ethyl 2-(3,4-dihydroxypyrrolidin-1-yl)sulfonylacetate |
|---|---|
| PubChem CID | 106672320 |
| Molecular Formula | C8H15NO6S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | ethyl 2-(3,4-dihydroxypyrrolidin-1-yl)sulfonylacetate |
| SMILES | CCOC(=O)CS(=O)(=O)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C8H15NO6S/c1-2-15-8(12)5-16(13,14)9-3-6(10)7(11)4-9/h6-7,10-11H,2-5H2,1H3 |
| InChIKey | NNVKYZKIQCPCOV-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |