C11H19NO6S — CID 79609171
2-[1-(2-ethoxy-2-oxoethyl)sulfonylpiperidin-4-yl]acetic acid (PubChem CID 79609171) has the molecular formula C11H19NO6S and a molecular weight of 293.34 g/mol. Its IUPAC name is 2-[1-(2-ethoxy-2-oxoethyl)sulfonylpiperidin-4-yl]acetic acid.
| Compound Name | 2-[1-(2-ethoxy-2-oxoethyl)sulfonylpiperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 79609171 |
| Molecular Formula | C11H19NO6S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-[1-(2-ethoxy-2-oxoethyl)sulfonylpiperidin-4-yl]acetic acid |
| SMILES | CCOC(=O)CS(=O)(=O)N1CCC(CC(=O)O)CC1 |
| InChI | InChI=1S/C11H19NO6S/c1-2-18-11(15)8-19(16,17)12-5-3-9(4-6-12)7-10(13)14/h9H,2-8H2,1H3,(H,13,14) |
| InChIKey | YAJHVYQMSHQKSL-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |