C13H25N3O2S — CID 63342443
ethyl 2-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]propanoate (PubChem CID 63342443) has the molecular formula C13H25N3O2S and a molecular weight of 287.43 g/mol. Its IUPAC name is ethyl 2-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]propanoate.
| Compound Name | ethyl 2-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 63342443 |
| Molecular Formula | C13H25N3O2S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | ethyl 2-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]propanoate |
| SMILES | CCOC(=O)C(C)N1CCN(C(C)(C)C(N)=S)CC1 |
| InChI | InChI=1S/C13H25N3O2S/c1-5-18-11(17)10(2)15-6-8-16(9-7-15)13(3,4)12(14)19/h10H,5-9H2,1-4H3,(H2,14,19) |
| InChIKey | HTJSOZOUJIJPGY-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|