About ethyl 2-piperidin-1-ylpropanoate;methanamine
ethyl 2-piperidin-1-ylpropanoate;methanamine (PubChem CID 143433031) has the molecular formula C11H24N2O2
and a molecular weight of 216.32 g/mol. Its IUPAC name is ethyl 2-piperidin-1-ylpropanoate;methanamine.
Molecular Properties
| Compound Name | ethyl 2-piperidin-1-ylpropanoate;methanamine |
| PubChem CID | 143433031 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | ethyl 2-piperidin-1-ylpropanoate;methanamine |
| SMILES | CCOC(=O)C(C)N1CCCCC1.CN |
| InChI | InChI=1S/C10H19NO2.CH5N/c1-3-13-10(12)9(2)11-7-5-4-6-8-11;1-2/h9H,3-8H2,1-2H3;2H2,1H3 |
| InChIKey | NUAJHEPTCMPIHA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-piperidin-1-ylpropanoate;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-piperidin-1-ylpropanoate;methanamine?
The IUPAC name of ethyl 2-piperidin-1-ylpropanoate;methanamine (CID 143433031) is ethyl 2-piperidin-1-ylpropanoate;methanamine.
What is the SMILES notation for ethyl 2-piperidin-1-ylpropanoate;methanamine?
The canonical SMILES for ethyl 2-piperidin-1-ylpropanoate;methanamine is CCOC(=O)C(C)N1CCCCC1.CN.
What is the InChIKey of ethyl 2-piperidin-1-ylpropanoate;methanamine?
The InChIKey is NUAJHEPTCMPIHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2.CH5N/c1-3-13-10(12)9(2)11-7-5-4-6-8-11;1-2/h9H,3-8H2,1-2H3;2H2,1H3.
What are the key properties of ethyl 2-piperidin-1-ylpropanoate;methanamine?
ethyl 2-piperidin-1-ylpropanoate;methanamine has a molecular weight of 216.32 g/mol, XLogP of 1.00, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-piperidin-1-ylpropanoate;methanamine is sourced from PubChem (CID 143433031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).