About 2-ethylhexyl 2-pyrrolidin-1-ylpropanoate
2-ethylhexyl 2-pyrrolidin-1-ylpropanoate (PubChem CID 141096243) has the molecular formula C15H29NO2
and a molecular weight of 255.40 g/mol. Its IUPAC name is 2-ethylhexyl 2-pyrrolidin-1-ylpropanoate.
Molecular Properties
| Compound Name | 2-ethylhexyl 2-pyrrolidin-1-ylpropanoate |
| PubChem CID | 141096243 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | 2-ethylhexyl 2-pyrrolidin-1-ylpropanoate |
| SMILES | CCCCC(CC)COC(=O)C(C)N1CCCC1 |
| InChI | InChI=1S/C15H29NO2/c1-4-6-9-14(5-2)12-18-15(17)13(3)16-10-7-8-11-16/h13-14H,4-12H2,1-3H3 |
| InChIKey | MZXYUVYZIZRZEW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethylhexyl 2-pyrrolidin-1-ylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl 2-pyrrolidin-1-ylpropanoate?
The IUPAC name of 2-ethylhexyl 2-pyrrolidin-1-ylpropanoate (CID 141096243) is 2-ethylhexyl 2-pyrrolidin-1-ylpropanoate.
What is the SMILES notation for 2-ethylhexyl 2-pyrrolidin-1-ylpropanoate?
The canonical SMILES for 2-ethylhexyl 2-pyrrolidin-1-ylpropanoate is CCCCC(CC)COC(=O)C(C)N1CCCC1.
What is the InChIKey of 2-ethylhexyl 2-pyrrolidin-1-ylpropanoate?
The InChIKey is MZXYUVYZIZRZEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO2/c1-4-6-9-14(5-2)12-18-15(17)13(3)16-10-7-8-11-16/h13-14H,4-12H2,1-3H3.
What are the key properties of 2-ethylhexyl 2-pyrrolidin-1-ylpropanoate?
2-ethylhexyl 2-pyrrolidin-1-ylpropanoate has a molecular weight of 255.40 g/mol, XLogP of 3.23, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl 2-pyrrolidin-1-ylpropanoate is sourced from PubChem (CID 141096243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).