C23H36N2O4 — CID 161163924
benzyl 2-pyrrolidin-1-ylacetate;ethyl 2-piperidin-1-ylpropanoate (PubChem CID 161163924) has the molecular formula C23H36N2O4 and a molecular weight of 404.55 g/mol. Its IUPAC name is benzyl 2-pyrrolidin-1-ylacetate;ethyl 2-piperidin-1-ylpropanoate.
| Compound Name | benzyl 2-pyrrolidin-1-ylacetate;ethyl 2-piperidin-1-ylpropanoate |
|---|---|
| PubChem CID | 161163924 |
| Molecular Formula | C23H36N2O4 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | benzyl 2-pyrrolidin-1-ylacetate;ethyl 2-piperidin-1-ylpropanoate |
| SMILES | CCOC(=O)C(C)N1CCCCC1.O=C(CN1CCCC1)OCc1ccccc1 |
| InChI | InChI=1S/C13H17NO2.C10H19NO2/c15-13(10-14-8-4-5-9-14)16-11-12-6-2-1-3-7-12;1-3-13-10(12)9(2)11-7-5-4-6-8-11/h1-3,6-7H,4-5,8-11H2;9H,3-8H2,1-2H3 |
| InChIKey | UQGWEDMSVKLMIE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |