C26H46N4O4 — CID 22971865
benzyl 2-[4-(2-methylperoxyethyl)-7,10-dipropyl-1,4,7,10-tetrazacyclododec-1-yl]acetate (PubChem CID 22971865) has the molecular formula C26H46N4O4 and a molecular weight of 478.68 g/mol. Its IUPAC name is benzyl 2-[4-(2-methylperoxyethyl)-7,10-dipropyl-1,4,7,10-tetrazacyclododec-1-yl]acetate.
| Compound Name | benzyl 2-[4-(2-methylperoxyethyl)-7,10-dipropyl-1,4,7,10-tetrazacyclododec-1-yl]acetate |
|---|---|
| PubChem CID | 22971865 |
| Molecular Formula | C26H46N4O4 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.35 |
| IUPAC Name | benzyl 2-[4-(2-methylperoxyethyl)-7,10-dipropyl-1,4,7,10-tetrazacyclododec-1-yl]acetate |
| SMILES | CCCN1CCN(CCC)CCN(CC(=O)OCc2ccccc2)CCN(CCOOC)CC1 |
| InChI | InChI=1S/C26H46N4O4/c1-4-11-27-13-14-28(12-5-2)17-19-30(20-18-29(16-15-27)21-22-34-32-3)23-26(31)33-24-25-9-7-6-8-10-25/h6-10H,4-5,11-24H2,1-3H3 |
| InChIKey | WBWQOYZHGBCBAI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 57.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|