C12H23N3O2S — CID 63342230
methyl 2-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]propanoate (PubChem CID 63342230) has the molecular formula C12H23N3O2S and a molecular weight of 273.40 g/mol. Its IUPAC name is methyl 2-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]propanoate.
| Compound Name | methyl 2-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 63342230 |
| Molecular Formula | C12H23N3O2S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | methyl 2-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]propanoate |
| SMILES | COC(=O)C(C)N1CCN(C(C)(C)C(N)=S)CC1 |
| InChI | InChI=1S/C12H23N3O2S/c1-9(10(16)17-4)14-5-7-15(8-6-14)12(2,3)11(13)18/h9H,5-8H2,1-4H3,(H2,13,18) |
| InChIKey | CXOCORHRPBQOLF-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|