C11H21N3O2S — CID 63342231
2-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]propanoic acid (PubChem CID 63342231) has the molecular formula C11H21N3O2S and a molecular weight of 259.38 g/mol. Its IUPAC name is 2-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]propanoic acid.
| Compound Name | 2-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 63342231 |
| Molecular Formula | C11H21N3O2S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 2-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]propanoic acid |
| SMILES | CC(C(=O)O)N1CCN(C(C)(C)C(N)=S)CC1 |
| InChI | InChI=1S/C11H21N3O2S/c1-8(9(15)16)13-4-6-14(7-5-13)11(2,3)10(12)17/h8H,4-7H2,1-3H3,(H2,12,17)(H,15,16) |
| InChIKey | OMJXKHPCEMIDHK-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|